C13H21BrN2 — CID 116950044
1-(2-bromophenyl)-N,2,2-trimethylbutane-1,4-diamine (PubChem CID 116950044) has the molecular formula C13H21BrN2 and a molecular weight of 285.23 g/mol. Its IUPAC name is 1-(2-bromophenyl)-N,2,2-trimethylbutane-1,4-diamine.
| Compound Name | 1-(2-bromophenyl)-N,2,2-trimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 116950044 |
| Molecular Formula | C13H21BrN2 |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 1-(2-bromophenyl)-N,2,2-trimethylbutane-1,4-diamine |
| SMILES | CNC(c1ccccc1Br)C(C)(C)CCN |
| InChI | InChI=1S/C13H21BrN2/c1-13(2,8-9-15)12(16-3)10-6-4-5-7-11(10)14/h4-7,12,16H,8-9,15H2,1-3H3 |
| InChIKey | BSBJPOSXQVMWFU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |