C12H22N2O — CID 116950035
N,2,2-trimethyl-1-(5-methylfuran-2-yl)butane-1,4-diamine (PubChem CID 116950035) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is N,2,2-trimethyl-1-(5-methylfuran-2-yl)butane-1,4-diamine.
| Compound Name | N,2,2-trimethyl-1-(5-methylfuran-2-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 116950035 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | N,2,2-trimethyl-1-(5-methylfuran-2-yl)butane-1,4-diamine |
| SMILES | CNC(c1ccc(C)o1)C(C)(C)CCN |
| InChI | InChI=1S/C12H22N2O/c1-9-5-6-10(15-9)11(14-4)12(2,3)7-8-13/h5-6,11,14H,7-8,13H2,1-4H3 |
| InChIKey | USZLWYSXHYBGOI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |