C9H12F3NO — CID 171231975
(1S)-4,4,4-trifluoro-1-(5-methylfuran-2-yl)butan-1-amine (PubChem CID 171231975) has the molecular formula C9H12F3NO and a molecular weight of 207.19 g/mol. Its IUPAC name is (1S)-4,4,4-trifluoro-1-(5-methylfuran-2-yl)butan-1-amine.
| Compound Name | (1S)-4,4,4-trifluoro-1-(5-methylfuran-2-yl)butan-1-amine |
|---|---|
| PubChem CID | 171231975 |
| Molecular Formula | C9H12F3NO |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (1S)-4,4,4-trifluoro-1-(5-methylfuran-2-yl)butan-1-amine |
| SMILES | Cc1ccc([C@@H](N)CCC(F)(F)F)o1 |
| InChI | InChI=1S/C9H12F3NO/c1-6-2-3-8(14-6)7(13)4-5-9(10,11)12/h2-3,7H,4-5,13H2,1H3/t7-/m0/s1 |
| InChIKey | GMPMESBBEKJVBI-ZETCQYMHSA-N |
| XLogP | 2.93 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |