C10H18N2O — CID 116933940
N'-methyl-1-(5-methylfuran-2-yl)butane-1,4-diamine (PubChem CID 116933940) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is N'-methyl-1-(5-methylfuran-2-yl)butane-1,4-diamine.
| Compound Name | N'-methyl-1-(5-methylfuran-2-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 116933940 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | N'-methyl-1-(5-methylfuran-2-yl)butane-1,4-diamine |
| SMILES | CNCCCC(N)c1ccc(C)o1 |
| InChI | InChI=1S/C10H18N2O/c1-8-5-6-10(13-8)9(11)4-3-7-12-2/h5-6,9,12H,3-4,7,11H2,1-2H3 |
| InChIKey | OHVRPOVCICDLEV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|