C9H12F3NO2 — CID 171231086
[5-[(1S)-1-amino-4,4,4-trifluorobutyl]furan-2-yl]methanol (PubChem CID 171231086) has the molecular formula C9H12F3NO2 and a molecular weight of 223.19 g/mol. Its IUPAC name is [5-[(1S)-1-amino-4,4,4-trifluorobutyl]furan-2-yl]methanol.
| Compound Name | [5-[(1S)-1-amino-4,4,4-trifluorobutyl]furan-2-yl]methanol |
|---|---|
| PubChem CID | 171231086 |
| Molecular Formula | C9H12F3NO2 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | [5-[(1S)-1-amino-4,4,4-trifluorobutyl]furan-2-yl]methanol |
| SMILES | N[C@@H](CCC(F)(F)F)c1ccc(CO)o1 |
| InChI | InChI=1S/C9H12F3NO2/c10-9(11,12)4-3-7(13)8-2-1-6(5-14)15-8/h1-2,7,14H,3-5,13H2/t7-/m0/s1 |
| InChIKey | BGYBUVWTXTTWGZ-ZETCQYMHSA-N |
| XLogP | 2.11 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |