C8H14N2O2 — CID 171231063
[5-[(1S)-1,3-diaminopropyl]furan-2-yl]methanol (PubChem CID 171231063) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is [5-[(1S)-1,3-diaminopropyl]furan-2-yl]methanol.
| Compound Name | [5-[(1S)-1,3-diaminopropyl]furan-2-yl]methanol |
|---|---|
| PubChem CID | 171231063 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | [5-[(1S)-1,3-diaminopropyl]furan-2-yl]methanol |
| SMILES | NCC[C@H](N)c1ccc(CO)o1 |
| InChI | InChI=1S/C8H14N2O2/c9-4-3-7(10)8-2-1-6(5-11)12-8/h1-2,7,11H,3-5,9-10H2/t7-/m0/s1 |
| InChIKey | QRZDHDPRDWJZQK-ZETCQYMHSA-N |
| XLogP | 0.12 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |