C7H11BrN2O — CID 130817286
(1S)-1-(5-bromofuran-2-yl)propane-1,3-diamine (PubChem CID 130817286) has the molecular formula C7H11BrN2O and a molecular weight of 219.08 g/mol. Its IUPAC name is (1S)-1-(5-bromofuran-2-yl)propane-1,3-diamine.
| Compound Name | (1S)-1-(5-bromofuran-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 130817286 |
| Molecular Formula | C7H11BrN2O |
| Molecular Weight | 219.08 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | (1S)-1-(5-bromofuran-2-yl)propane-1,3-diamine |
| SMILES | NCC[C@H](N)c1ccc(Br)o1 |
| InChI | InChI=1S/C7H11BrN2O/c8-7-2-1-6(11-7)5(10)3-4-9/h1-2,5H,3-4,9-10H2/t5-/m0/s1 |
| InChIKey | YQWKRNVSDUZHCS-YFKPBYRVSA-N |
| XLogP | 1.39 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.08 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |