C6H6BrF2NO — CID 130673890
(1R)-1-(5-bromofuran-2-yl)-2,2-difluoroethanamine (PubChem CID 130673890) has the molecular formula C6H6BrF2NO and a molecular weight of 226.02 g/mol. Its IUPAC name is (1R)-1-(5-bromofuran-2-yl)-2,2-difluoroethanamine.
| Compound Name | (1R)-1-(5-bromofuran-2-yl)-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 130673890 |
| Molecular Formula | C6H6BrF2NO |
| Molecular Weight | 226.02 g/mol |
| Exact Mass | 224.96 |
| IUPAC Name | (1R)-1-(5-bromofuran-2-yl)-2,2-difluoroethanamine |
| SMILES | N[C@H](c1ccc(Br)o1)C(F)F |
| InChI | InChI=1S/C6H6BrF2NO/c7-4-2-1-3(11-4)5(10)6(8)9/h1-2,5-6H,10H2/t5-/m1/s1 |
| InChIKey | CWHNNQTVSGIQHU-RXMQYKEDSA-N |
| XLogP | 2.31 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.02 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |