C9H16ClNO2 — CID 171231073
[5-[(1S)-1-aminobutyl]furan-2-yl]methanol;hydrochloride (PubChem CID 171231073) has the molecular formula C9H16ClNO2 and a molecular weight of 205.68 g/mol. Its IUPAC name is [5-[(1S)-1-aminobutyl]furan-2-yl]methanol;hydrochloride.
| Compound Name | [5-[(1S)-1-aminobutyl]furan-2-yl]methanol;hydrochloride |
|---|---|
| PubChem CID | 171231073 |
| Molecular Formula | C9H16ClNO2 |
| Molecular Weight | 205.68 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | [5-[(1S)-1-aminobutyl]furan-2-yl]methanol;hydrochloride |
| SMILES | CCC[C@H](N)c1ccc(CO)o1.Cl |
| InChI | InChI=1S/C9H15NO2.ClH/c1-2-3-8(10)9-5-4-7(6-11)12-9;/h4-5,8,11H,2-3,6,10H2,1H3;1H/t8-;/m0./s1 |
| InChIKey | DJKVBEPXYLXODB-QRPNPIFTSA-N |
| XLogP | 1.99 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.68 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |