C10H14FNO4 — CID 171243533
ethyl (3R)-3-amino-2-fluoro-3-[5-(hydroxymethyl)furan-2-yl]propanoate (PubChem CID 171243533) has the molecular formula C10H14FNO4 and a molecular weight of 231.22 g/mol. Its IUPAC name is ethyl (3R)-3-amino-2-fluoro-3-[5-(hydroxymethyl)furan-2-yl]propanoate.
| Compound Name | ethyl (3R)-3-amino-2-fluoro-3-[5-(hydroxymethyl)furan-2-yl]propanoate |
|---|---|
| PubChem CID | 171243533 |
| Molecular Formula | C10H14FNO4 |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | ethyl (3R)-3-amino-2-fluoro-3-[5-(hydroxymethyl)furan-2-yl]propanoate |
| SMILES | CCOC(=O)C(F)[C@H](N)c1ccc(CO)o1 |
| InChI | InChI=1S/C10H14FNO4/c1-2-15-10(14)8(11)9(12)7-4-3-6(5-13)16-7/h3-4,8-9,13H,2,5,12H2,1H3/t8?,9-/m1/s1 |
| InChIKey | FJMXHUOSQARKPO-YGPZHTELSA-N |
| XLogP | 0.67 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |