C9H12ClFN2O5 — CID 171245657
ethyl (3S)-3-amino-2-fluoro-3-(5-nitrofuran-2-yl)propanoate;hydrochloride (PubChem CID 171245657) has the molecular formula C9H12ClFN2O5 and a molecular weight of 282.66 g/mol. Its IUPAC name is ethyl (3S)-3-amino-2-fluoro-3-(5-nitrofuran-2-yl)propanoate;hydrochloride.
| Compound Name | ethyl (3S)-3-amino-2-fluoro-3-(5-nitrofuran-2-yl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171245657 |
| Molecular Formula | C9H12ClFN2O5 |
| Molecular Weight | 282.66 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | ethyl (3S)-3-amino-2-fluoro-3-(5-nitrofuran-2-yl)propanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)[C@@H](N)c1ccc([N+](=O)[O-])o1.Cl |
| InChI | InChI=1S/C9H11FN2O5.ClH/c1-2-16-9(13)7(10)8(11)5-3-4-6(17-5)12(14)15;/h3-4,7-8H,2,11H2,1H3;1H/t7?,8-;/m0./s1 |
| InChIKey | QIRYEJPIIRHRRX-MTICXXPYSA-N |
| XLogP | 1.51 |
| TPSA | 108.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.66 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|