C8H14ClN3O3 — CID 171217848
(1S)-1-(5-nitrofuran-2-yl)butane-1,4-diamine;hydrochloride (PubChem CID 171217848) has the molecular formula C8H14ClN3O3 and a molecular weight of 235.67 g/mol. Its IUPAC name is (1S)-1-(5-nitrofuran-2-yl)butane-1,4-diamine;hydrochloride.
| Compound Name | (1S)-1-(5-nitrofuran-2-yl)butane-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 171217848 |
| Molecular Formula | C8H14ClN3O3 |
| Molecular Weight | 235.67 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | (1S)-1-(5-nitrofuran-2-yl)butane-1,4-diamine;hydrochloride |
| SMILES | Cl.NCCC[C@H](N)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C8H13N3O3.ClH/c9-5-1-2-6(10)7-3-4-8(14-7)11(12)13;/h3-4,6H,1-2,5,9-10H2;1H/t6-;/m0./s1 |
| InChIKey | SJMLXYATTJNZTL-RGMNGODLSA-N |
| XLogP | 1.35 |
| TPSA | 108.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.67 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|