C14H16N2O5 — CID 61080311
2-(3,4-dimethoxyphenyl)-1-(5-nitrofuran-2-yl)ethanamine (PubChem CID 61080311) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1-(5-nitrofuran-2-yl)ethanamine.
| Compound Name | 2-(3,4-dimethoxyphenyl)-1-(5-nitrofuran-2-yl)ethanamine |
|---|---|
| PubChem CID | 61080311 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1-(5-nitrofuran-2-yl)ethanamine |
| SMILES | COc1ccc(CC(N)c2ccc([N+](=O)[O-])o2)cc1OC |
| InChI | InChI=1S/C14H16N2O5/c1-19-12-4-3-9(8-13(12)20-2)7-10(15)11-5-6-14(21-11)16(17)18/h3-6,8,10H,7,15H2,1-2H3 |
| InChIKey | HTEKYIAYIZWVQP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 100.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|