C15H16N2O7 — CID 90613302
N-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-5-nitrofuran-2-carboxamide (PubChem CID 90613302) has the molecular formula C15H16N2O7 and a molecular weight of 336.30 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 90613302 |
| Molecular Formula | C15H16N2O7 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-5-nitrofuran-2-carboxamide |
| SMILES | COc1ccc(C(O)CNC(=O)c2ccc([N+](=O)[O-])o2)cc1OC |
| InChI | InChI=1S/C15H16N2O7/c1-22-11-4-3-9(7-13(11)23-2)10(18)8-16-15(19)12-5-6-14(24-12)17(20)21/h3-7,10,18H,8H2,1-2H3,(H,16,19) |
| InChIKey | AMYKHOQJSGWRGX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 124.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|