C20H22N2O7 — CID 90613624
N-(1,3-benzodioxol-5-ylmethyl)-N'-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]oxamide (PubChem CID 90613624) has the molecular formula C20H22N2O7 and a molecular weight of 402.40 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]oxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]oxamide |
|---|---|
| PubChem CID | 90613624 |
| Molecular Formula | C20H22N2O7 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]oxamide |
| SMILES | COc1ccc(C(O)CNC(=O)C(=O)NCc2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C20H22N2O7/c1-26-15-6-4-13(8-17(15)27-2)14(23)10-22-20(25)19(24)21-9-12-3-5-16-18(7-12)29-11-28-16/h3-8,14,23H,9-11H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | IBJLDGHROVVCRD-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|