C20H22N2O6 — CID 90623597
N-(1,3-benzodioxol-5-ylmethyl)-N'-[2-methoxy-2-(3-methoxyphenyl)ethyl]oxamide (PubChem CID 90623597) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-[2-methoxy-2-(3-methoxyphenyl)ethyl]oxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[2-methoxy-2-(3-methoxyphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 90623597 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[2-methoxy-2-(3-methoxyphenyl)ethyl]oxamide |
| SMILES | COc1cccc(C(CNC(=O)C(=O)NCc2ccc3c(c2)OCO3)OC)c1 |
| InChI | InChI=1S/C20H22N2O6/c1-25-15-5-3-4-14(9-15)18(26-2)11-22-20(24)19(23)21-10-13-6-7-16-17(8-13)28-12-27-16/h3-9,18H,10-12H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | BDCBRVOBCINFEO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|