C18H20N2O6 — CID 47005175
2-(3,4-dimethoxyphenyl)-N-[2-hydroxy-2-(4-nitrophenyl)ethyl]acetamide (PubChem CID 47005175) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[2-hydroxy-2-(4-nitrophenyl)ethyl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[2-hydroxy-2-(4-nitrophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 47005175 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[2-hydroxy-2-(4-nitrophenyl)ethyl]acetamide |
| SMILES | COc1ccc(CC(=O)NCC(O)c2ccc([N+](=O)[O-])cc2)cc1OC |
| InChI | InChI=1S/C18H20N2O6/c1-25-16-8-3-12(9-17(16)26-2)10-18(22)19-11-15(21)13-4-6-14(7-5-13)20(23)24/h3-9,15,21H,10-11H2,1-2H3,(H,19,22) |
| InChIKey | PXSYUQDQXOBUEF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|