C20H24N2O6 — CID 43004372
N-[2-hydroxy-2-(4-nitrophenyl)ethyl]-3-methoxy-4-(2-methylpropoxy)benzamide (PubChem CID 43004372) has the molecular formula C20H24N2O6 and a molecular weight of 388.42 g/mol. Its IUPAC name is N-[2-hydroxy-2-(4-nitrophenyl)ethyl]-3-methoxy-4-(2-methylpropoxy)benzamide.
| Compound Name | N-[2-hydroxy-2-(4-nitrophenyl)ethyl]-3-methoxy-4-(2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 43004372 |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N-[2-hydroxy-2-(4-nitrophenyl)ethyl]-3-methoxy-4-(2-methylpropoxy)benzamide |
| SMILES | COc1cc(C(=O)NCC(O)c2ccc([N+](=O)[O-])cc2)ccc1OCC(C)C |
| InChI | InChI=1S/C20H24N2O6/c1-13(2)12-28-18-9-6-15(10-19(18)27-3)20(24)21-11-17(23)14-4-7-16(8-5-14)22(25)26/h4-10,13,17,23H,11-12H2,1-3H3,(H,21,24) |
| InChIKey | ZHLVXGPXPPTOQJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|