C17H18N2O4 — CID 40952776
N-[(2R)-2-hydroxy-2-(4-nitrophenyl)ethyl]-3,4-dimethylbenzamide (PubChem CID 40952776) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is N-[(2R)-2-hydroxy-2-(4-nitrophenyl)ethyl]-3,4-dimethylbenzamide.
| Compound Name | N-[(2R)-2-hydroxy-2-(4-nitrophenyl)ethyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 40952776 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | N-[(2R)-2-hydroxy-2-(4-nitrophenyl)ethyl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NC[C@H](O)c2ccc([N+](=O)[O-])cc2)cc1C |
| InChI | InChI=1S/C17H18N2O4/c1-11-3-4-14(9-12(11)2)17(21)18-10-16(20)13-5-7-15(8-6-13)19(22)23/h3-9,16,20H,10H2,1-2H3,(H,18,21)/t16-/m0/s1 |
| InChIKey | JFZHOGSYQPMWDQ-INIZCTEOSA-N |
| XLogP | 2.68 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|