C26H26N4O8 — CID 5254511
N-[[3-methoxy-4-(2-methylpropoxy)phenyl]-[(3-nitrobenzoyl)amino]methyl]-3-nitrobenzamide (PubChem CID 5254511) has the molecular formula C26H26N4O8 and a molecular weight of 522.51 g/mol. Its IUPAC name is N-[[3-methoxy-4-(2-methylpropoxy)phenyl]-[(3-nitrobenzoyl)amino]methyl]-3-nitrobenzamide.
| Compound Name | N-[[3-methoxy-4-(2-methylpropoxy)phenyl]-[(3-nitrobenzoyl)amino]methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 5254511 |
| Molecular Formula | C26H26N4O8 |
| Molecular Weight | 522.51 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | N-[[3-methoxy-4-(2-methylpropoxy)phenyl]-[(3-nitrobenzoyl)amino]methyl]-3-nitrobenzamide |
| SMILES | COc1cc(C(NC(=O)c2cccc([N+](=O)[O-])c2)NC(=O)c2cccc([N+](=O)[O-])c2)ccc1OCC(C)C |
| InChI | InChI=1S/C26H26N4O8/c1-16(2)15-38-22-11-10-17(14-23(22)37-3)24(27-25(31)18-6-4-8-20(12-18)29(33)34)28-26(32)19-7-5-9-21(13-19)30(35)36/h4-14,16,24H,15H2,1-3H3,(H,27,31)(H,28,32) |
| InChIKey | ODAXUABXYGPCOV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 162.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|