C29H23ClN4O8 — CID 5245244
N-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-[(3-nitrobenzoyl)amino]methyl]-3-nitrobenzamide (PubChem CID 5245244) has the molecular formula C29H23ClN4O8 and a molecular weight of 590.98 g/mol. Its IUPAC name is N-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-[(3-nitrobenzoyl)amino]methyl]-3-nitrobenzamide.
| Compound Name | N-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-[(3-nitrobenzoyl)amino]methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 5245244 |
| Molecular Formula | C29H23ClN4O8 |
| Molecular Weight | 590.98 g/mol |
| Exact Mass | 590.12 |
| IUPAC Name | N-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-[(3-nitrobenzoyl)amino]methyl]-3-nitrobenzamide |
| SMILES | COc1cc(C(NC(=O)c2cccc([N+](=O)[O-])c2)NC(=O)c2cccc([N+](=O)[O-])c2)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C29H23ClN4O8/c1-41-26-16-18(12-13-25(26)42-17-21-6-2-3-11-24(21)30)27(31-28(35)19-7-4-9-22(14-19)33(37)38)32-29(36)20-8-5-10-23(15-20)34(39)40/h2-16,27H,17H2,1H3,(H,31,35)(H,32,36) |
| InChIKey | MMVHPVIXRWVXFH-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 162.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.98 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|