C22H21ClN2O3 — CID 25352738
4-[(2-chlorophenyl)methoxy]-3-methoxy-N-[(1S)-1-pyridin-4-ylethyl]benzamide (PubChem CID 25352738) has the molecular formula C22H21ClN2O3 and a molecular weight of 396.87 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methoxy]-3-methoxy-N-[(1S)-1-pyridin-4-ylethyl]benzamide.
| Compound Name | 4-[(2-chlorophenyl)methoxy]-3-methoxy-N-[(1S)-1-pyridin-4-ylethyl]benzamide |
|---|---|
| PubChem CID | 25352738 |
| Molecular Formula | C22H21ClN2O3 |
| Molecular Weight | 396.87 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 4-[(2-chlorophenyl)methoxy]-3-methoxy-N-[(1S)-1-pyridin-4-ylethyl]benzamide |
| SMILES | COc1cc(C(=O)N[C@@H](C)c2ccncc2)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C22H21ClN2O3/c1-15(16-9-11-24-12-10-16)25-22(26)17-7-8-20(21(13-17)27-2)28-14-18-5-3-4-6-19(18)23/h3-13,15H,14H2,1-2H3,(H,25,26)/t15-/m0/s1 |
| InChIKey | USLOUNQGIMOOKT-HNNXBMFYSA-N |
| XLogP | 4.81 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.87 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |