C26H28ClNO2 — CID 132666759
N-[1-(4-tert-butylphenyl)ethyl]-4-[(2-chlorophenyl)methoxy]benzamide (PubChem CID 132666759) has the molecular formula C26H28ClNO2 and a molecular weight of 421.97 g/mol. Its IUPAC name is N-[1-(4-tert-butylphenyl)ethyl]-4-[(2-chlorophenyl)methoxy]benzamide.
| Compound Name | N-[1-(4-tert-butylphenyl)ethyl]-4-[(2-chlorophenyl)methoxy]benzamide |
|---|---|
| PubChem CID | 132666759 |
| Molecular Formula | C26H28ClNO2 |
| Molecular Weight | 421.97 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | N-[1-(4-tert-butylphenyl)ethyl]-4-[(2-chlorophenyl)methoxy]benzamide |
| SMILES | CC(NC(=O)c1ccc(OCc2ccccc2Cl)cc1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H28ClNO2/c1-18(19-9-13-22(14-10-19)26(2,3)4)28-25(29)20-11-15-23(16-12-20)30-17-21-7-5-6-8-24(21)27/h5-16,18H,17H2,1-4H3,(H,28,29) |
| InChIKey | LBFYUFPDQJPTET-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.97 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |