C23H22ClNO4S — CID 133165582
4-[(2-chlorophenyl)methoxy]-N-[1-(4-methylsulfonylphenyl)ethyl]benzamide (PubChem CID 133165582) has the molecular formula C23H22ClNO4S and a molecular weight of 443.95 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methoxy]-N-[1-(4-methylsulfonylphenyl)ethyl]benzamide.
| Compound Name | 4-[(2-chlorophenyl)methoxy]-N-[1-(4-methylsulfonylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 133165582 |
| Molecular Formula | C23H22ClNO4S |
| Molecular Weight | 443.95 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 4-[(2-chlorophenyl)methoxy]-N-[1-(4-methylsulfonylphenyl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1ccc(OCc2ccccc2Cl)cc1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C23H22ClNO4S/c1-16(17-9-13-21(14-10-17)30(2,27)28)25-23(26)18-7-11-20(12-8-18)29-15-19-5-3-4-6-22(19)24/h3-14,16H,15H2,1-2H3,(H,25,26) |
| InChIKey | OZVWONFEILNRJY-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.95 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |