C16H18N2O2 — CID 18160597
3-methoxy-4-methyl-N-(1-pyridin-4-ylethyl)benzamide (PubChem CID 18160597) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 3-methoxy-4-methyl-N-(1-pyridin-4-ylethyl)benzamide.
| Compound Name | 3-methoxy-4-methyl-N-(1-pyridin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 18160597 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 3-methoxy-4-methyl-N-(1-pyridin-4-ylethyl)benzamide |
| SMILES | COc1cc(C(=O)NC(C)c2ccncc2)ccc1C |
| InChI | InChI=1S/C16H18N2O2/c1-11-4-5-14(10-15(11)20-3)16(19)18-12(2)13-6-8-17-9-7-13/h4-10,12H,1-3H3,(H,18,19) |
| InChIKey | FKXPVEOOSAQAOG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |