C16H17N3O7S — CID 1009767
2-(3,4-dimethoxyphenyl)-N'-(4-nitrophenyl)sulfonylacetohydrazide (PubChem CID 1009767) has the molecular formula C16H17N3O7S and a molecular weight of 395.39 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N'-(4-nitrophenyl)sulfonylacetohydrazide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N'-(4-nitrophenyl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 1009767 |
| Molecular Formula | C16H17N3O7S |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N'-(4-nitrophenyl)sulfonylacetohydrazide |
| SMILES | COc1ccc(CC(=O)NNS(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1OC |
| InChI | InChI=1S/C16H17N3O7S/c1-25-14-8-3-11(9-15(14)26-2)10-16(20)17-18-27(23,24)13-6-4-12(5-7-13)19(21)22/h3-9,18H,10H2,1-2H3,(H,17,20) |
| InChIKey | IAQAINCIORHADW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|