C31H28N2O11 — CID 142685893
bis[2-[(3,4-dimethoxyphenyl)methyl]-4-nitrophenyl] carbonate (PubChem CID 142685893) has the molecular formula C31H28N2O11 and a molecular weight of 604.57 g/mol. Its IUPAC name is bis[2-[(3,4-dimethoxyphenyl)methyl]-4-nitrophenyl] carbonate.
| Compound Name | bis[2-[(3,4-dimethoxyphenyl)methyl]-4-nitrophenyl] carbonate |
|---|---|
| PubChem CID | 142685893 |
| Molecular Formula | C31H28N2O11 |
| Molecular Weight | 604.57 g/mol |
| Exact Mass | 604.17 |
| IUPAC Name | bis[2-[(3,4-dimethoxyphenyl)methyl]-4-nitrophenyl] carbonate |
| SMILES | COc1ccc(Cc2cc([N+](=O)[O-])ccc2OC(=O)Oc2ccc([N+](=O)[O-])cc2Cc2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C31H28N2O11/c1-39-27-9-5-19(15-29(27)41-3)13-21-17-23(32(35)36)7-11-25(21)43-31(34)44-26-12-8-24(33(37)38)18-22(26)14-20-6-10-28(40-2)30(16-20)42-4/h5-12,15-18H,13-14H2,1-4H3 |
| InChIKey | JOWLBFDZXMSCLN-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 158.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.57 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|