C32H28N2O13 — CID 88684809
3-[3-carboxy-4-[(3,4-dimethoxyphenyl)methyl]-2-nitrophenoxy]-6-[(3,4-dimethoxyphenyl)methyl]-2-nitrobenzoic acid (PubChem CID 88684809) has the molecular formula C32H28N2O13 and a molecular weight of 648.58 g/mol. Its IUPAC name is 3-[3-carboxy-4-[(3,4-dimethoxyphenyl)methyl]-2-nitrophenoxy]-6-[(3,4-dimethoxyphenyl)methyl]-2-nitrobenzoic acid.
| Compound Name | 3-[3-carboxy-4-[(3,4-dimethoxyphenyl)methyl]-2-nitrophenoxy]-6-[(3,4-dimethoxyphenyl)methyl]-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 88684809 |
| Molecular Formula | C32H28N2O13 |
| Molecular Weight | 648.58 g/mol |
| Exact Mass | 648.16 |
| IUPAC Name | 3-[3-carboxy-4-[(3,4-dimethoxyphenyl)methyl]-2-nitrophenoxy]-6-[(3,4-dimethoxyphenyl)methyl]-2-nitrobenzoic acid |
| SMILES | COc1ccc(Cc2ccc(Oc3ccc(Cc4ccc(OC)c(OC)c4)c(C(=O)O)c3[N+](=O)[O-])c([N+](=O)[O-])c2C(=O)O)cc1OC |
| InChI | InChI=1S/C32H28N2O13/c1-43-21-9-5-17(15-25(21)45-3)13-19-7-11-23(29(33(39)40)27(19)31(35)36)47-24-12-8-20(28(32(37)38)30(24)34(41)42)14-18-6-10-22(44-2)26(16-18)46-4/h5-12,15-16H,13-14H2,1-4H3,(H,35,36)(H,37,38) |
| InChIKey | QJKBNUCOEWPZCP-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 207.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.58 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|