C11H17NO6 — CID 174862254
(3,4-dimethoxyphenyl)methyl nitrate;methoxymethane (PubChem CID 174862254) has the molecular formula C11H17NO6 and a molecular weight of 259.26 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)methyl nitrate;methoxymethane.
| Compound Name | (3,4-dimethoxyphenyl)methyl nitrate;methoxymethane |
|---|---|
| PubChem CID | 174862254 |
| Molecular Formula | C11H17NO6 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | (3,4-dimethoxyphenyl)methyl nitrate;methoxymethane |
| SMILES | COC.COc1ccc(CO[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C9H11NO5.C2H6O/c1-13-8-4-3-7(5-9(8)14-2)6-15-10(11)12;1-3-2/h3-5H,6H2,1-2H3;1-2H3 |
| InChIKey | OKEWKQWMPIPHCF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|