1,2-dimethoxy-4-(methoxymethyl)benzene;sulfuryl dichloride

C10H14Cl2O5S — CID 87637876

IUPAC1,2-dimethoxy-4-(methoxymethyl)benzene;sulfuryl dichloride
SMILESCOCc1ccc(OC)c(OC)c1.O=S(=O)(Cl)Cl
InChIInChI=1S/C10H14O3.Cl2O2S/c1-11-7-8-4-5-9(12-2)10(6-8)13-3;1-5(2,3)4/h4-6H,7H2,1-3H3;
InChIKeyAIJLRQRXUKYOED-UHFFFAOYSA-N
MW317.19 g/mol
LogP2.56
Rot. Bonds4

About 1,2-dimethoxy-4-(methoxymethyl)benzene;sulfuryl dichloride

1,2-dimethoxy-4-(methoxymethyl)benzene;sulfuryl dichloride (PubChem CID 87637876) has the molecular formula C10H14Cl2O5S and a molecular weight of 317.19 g/mol. Its IUPAC name is 1,2-dimethoxy-4-(methoxymethyl)benzene;sulfuryl dichloride.

Molecular Properties

Compound Name1,2-dimethoxy-4-(methoxymethyl)benzene;sulfuryl dichloride
PubChem CID87637876
Molecular FormulaC10H14Cl2O5S
Molecular Weight317.19 g/mol
Exact Mass315.99
IUPAC Name1,2-dimethoxy-4-(methoxymethyl)benzene;sulfuryl dichloride
SMILESCOCc1ccc(OC)c(OC)c1.O=S(=O)(Cl)Cl
InChIInChI=1S/C10H14O3.Cl2O2S/c1-11-7-8-4-5-9(12-2)10(6-8)13-3;1-5(2,3)4/h4-6H,7H2,1-3H3;
InChIKeyAIJLRQRXUKYOED-UHFFFAOYSA-N
XLogP2.56
TPSA61.83 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500317.19
LogP ≤ 52.56
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze 1,2-dimethoxy-4-(methoxymethyl)benzene;sulfuryl dichloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,2-dimethoxy-4-(methoxymethyl)benzene;sulfuryl dichloride?
The IUPAC name of 1,2-dimethoxy-4-(methoxymethyl)benzene;sulfuryl dichloride (CID 87637876) is 1,2-dimethoxy-4-(methoxymethyl)benzene;sulfuryl dichloride.
What is the SMILES notation for 1,2-dimethoxy-4-(methoxymethyl)benzene;sulfuryl dichloride?
The canonical SMILES for 1,2-dimethoxy-4-(methoxymethyl)benzene;sulfuryl dichloride is COCc1ccc(OC)c(OC)c1.O=S(=O)(Cl)Cl.
What is the InChIKey of 1,2-dimethoxy-4-(methoxymethyl)benzene;sulfuryl dichloride?
The InChIKey is AIJLRQRXUKYOED-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3.Cl2O2S/c1-11-7-8-4-5-9(12-2)10(6-8)13-3;1-5(2,3)4/h4-6H,7H2,1-3H3;.
What are the key properties of 1,2-dimethoxy-4-(methoxymethyl)benzene;sulfuryl dichloride?
1,2-dimethoxy-4-(methoxymethyl)benzene;sulfuryl dichloride has a molecular weight of 317.19 g/mol, XLogP of 2.56, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethoxy-4-(methoxymethyl)benzene;sulfuryl dichloride is sourced from PubChem (CID 87637876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).