C10H14Cl2O5S — CID 87637876
1,2-dimethoxy-4-(methoxymethyl)benzene;sulfuryl dichloride (PubChem CID 87637876) has the molecular formula C10H14Cl2O5S and a molecular weight of 317.19 g/mol. Its IUPAC name is 1,2-dimethoxy-4-(methoxymethyl)benzene;sulfuryl dichloride.
| Compound Name | 1,2-dimethoxy-4-(methoxymethyl)benzene;sulfuryl dichloride |
|---|---|
| PubChem CID | 87637876 |
| Molecular Formula | C10H14Cl2O5S |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | 1,2-dimethoxy-4-(methoxymethyl)benzene;sulfuryl dichloride |
| SMILES | COCc1ccc(OC)c(OC)c1.O=S(=O)(Cl)Cl |
| InChI | InChI=1S/C10H14O3.Cl2O2S/c1-11-7-8-4-5-9(12-2)10(6-8)13-3;1-5(2,3)4/h4-6H,7H2,1-3H3; |
| InChIKey | AIJLRQRXUKYOED-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |