About 2-(4-nitrophenoxy)-N'-(4-nitrophenyl)sulfonylacetohydrazide
2-(4-nitrophenoxy)-N'-(4-nitrophenyl)sulfonylacetohydrazide (PubChem CID 19166679) has the molecular formula C14H12N4O8S
and a molecular weight of 396.34 g/mol. Its IUPAC name is 2-(4-nitrophenoxy)-N'-(4-nitrophenyl)sulfonylacetohydrazide.
Molecular Properties
| Compound Name | 2-(4-nitrophenoxy)-N'-(4-nitrophenyl)sulfonylacetohydrazide |
| PubChem CID | 19166679 |
| Molecular Formula | C14H12N4O8S |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 2-(4-nitrophenoxy)-N'-(4-nitrophenyl)sulfonylacetohydrazide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1)NNS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H12N4O8S/c19-14(9-26-12-5-1-10(2-6-12)17(20)21)15-16-27(24,25)13-7-3-11(4-8-13)18(22)23/h1-8,16H,9H2,(H,15,19) |
| InChIKey | IYRFJPBMIPNCIT-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 170.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-nitrophenoxy)-N'-(4-nitrophenyl)sulfonylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-nitrophenoxy)-N'-(4-nitrophenyl)sulfonylacetohydrazide?
The IUPAC name of 2-(4-nitrophenoxy)-N'-(4-nitrophenyl)sulfonylacetohydrazide (CID 19166679) is 2-(4-nitrophenoxy)-N'-(4-nitrophenyl)sulfonylacetohydrazide.
What is the SMILES notation for 2-(4-nitrophenoxy)-N'-(4-nitrophenyl)sulfonylacetohydrazide?
The canonical SMILES for 2-(4-nitrophenoxy)-N'-(4-nitrophenyl)sulfonylacetohydrazide is O=C(COc1ccc([N+](=O)[O-])cc1)NNS(=O)(=O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 2-(4-nitrophenoxy)-N'-(4-nitrophenyl)sulfonylacetohydrazide?
The InChIKey is IYRFJPBMIPNCIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4O8S/c19-14(9-26-12-5-1-10(2-6-12)17(20)21)15-16-27(24,25)13-7-3-11(4-8-13)18(22)23/h1-8,16H,9H2,(H,15,19).
What are the key properties of 2-(4-nitrophenoxy)-N'-(4-nitrophenyl)sulfonylacetohydrazide?
2-(4-nitrophenoxy)-N'-(4-nitrophenyl)sulfonylacetohydrazide has a molecular weight of 396.34 g/mol, XLogP of 0.89, 8 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-nitrophenoxy)-N'-(4-nitrophenyl)sulfonylacetohydrazide is sourced from PubChem (CID 19166679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).