C14H13ClN2O4S — CID 905489
N'-(benzenesulfonyl)-2-(4-chlorophenoxy)acetohydrazide (PubChem CID 905489) has the molecular formula C14H13ClN2O4S and a molecular weight of 340.79 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-2-(4-chlorophenoxy)acetohydrazide.
| Compound Name | N'-(benzenesulfonyl)-2-(4-chlorophenoxy)acetohydrazide |
|---|---|
| PubChem CID | 905489 |
| Molecular Formula | C14H13ClN2O4S |
| Molecular Weight | 340.79 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | N'-(benzenesulfonyl)-2-(4-chlorophenoxy)acetohydrazide |
| SMILES | O=C(COc1ccc(Cl)cc1)NNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H13ClN2O4S/c15-11-6-8-12(9-7-11)21-10-14(18)16-17-22(19,20)13-4-2-1-3-5-13/h1-9,17H,10H2,(H,16,18) |
| InChIKey | KOFTZNSHCFZVAE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.79 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|