C14H14ClN3O3S — CID 3265581
N'-(benzenesulfonamido)-2-(4-chlorophenoxy)ethanimidamide (PubChem CID 3265581) has the molecular formula C14H14ClN3O3S and a molecular weight of 339.80 g/mol. Its IUPAC name is N'-(benzenesulfonamido)-2-(4-chlorophenoxy)ethanimidamide.
| Compound Name | N'-(benzenesulfonamido)-2-(4-chlorophenoxy)ethanimidamide |
|---|---|
| PubChem CID | 3265581 |
| Molecular Formula | C14H14ClN3O3S |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | N'-(benzenesulfonamido)-2-(4-chlorophenoxy)ethanimidamide |
| SMILES | NC(COc1ccc(Cl)cc1)=NNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H14ClN3O3S/c15-11-6-8-12(9-7-11)21-10-14(16)17-18-22(19,20)13-4-2-1-3-5-13/h1-9,18H,10H2,(H2,16,17) |
| InChIKey | UIOFVZQNCNDOPI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|