C11H15N3O4S — CID 5192357
ethyl 3-amino-3-(benzenesulfonylhydrazinylidene)propanoate (PubChem CID 5192357) has the molecular formula C11H15N3O4S and a molecular weight of 285.33 g/mol. Its IUPAC name is ethyl 3-amino-3-(benzenesulfonylhydrazinylidene)propanoate.
| Compound Name | ethyl 3-amino-3-(benzenesulfonylhydrazinylidene)propanoate |
|---|---|
| PubChem CID | 5192357 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | ethyl 3-amino-3-(benzenesulfonylhydrazinylidene)propanoate |
| SMILES | CCOC(=O)CC(N)=NNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H15N3O4S/c1-2-18-11(15)8-10(12)13-14-19(16,17)9-6-4-3-5-7-9/h3-7,14H,2,8H2,1H3,(H2,12,13) |
| InChIKey | PNYRFOZLXMPPSK-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|