C36H32BrN2O4PS — CID 15471571
ethyl (4Z)-4-(benzenesulfonylhydrazinylidene)-4-(4-bromophenyl)-2-(triphenyl-λ5-phosphanylidene)butanoate (PubChem CID 15471571) has the molecular formula C36H32BrN2O4PS and a molecular weight of 699.61 g/mol. Its IUPAC name is ethyl (4Z)-4-(benzenesulfonylhydrazinylidene)-4-(4-bromophenyl)-2-(triphenyl-λ5-phosphanylidene)butanoate.
| Compound Name | ethyl (4Z)-4-(benzenesulfonylhydrazinylidene)-4-(4-bromophenyl)-2-(triphenyl-λ5-phosphanylidene)butanoate |
|---|---|
| PubChem CID | 15471571 |
| Molecular Formula | C36H32BrN2O4PS |
| Molecular Weight | 699.61 g/mol |
| Exact Mass | 698.10 |
| IUPAC Name | ethyl (4Z)-4-(benzenesulfonylhydrazinylidene)-4-(4-bromophenyl)-2-(triphenyl-λ5-phosphanylidene)butanoate |
| SMILES | CCOC(=O)C(C/C(=N/NS(=O)(=O)c1ccccc1)c1ccc(Br)cc1)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H32BrN2O4PS/c1-2-43-36(40)35(27-34(28-23-25-29(37)26-24-28)38-39-45(41,42)33-21-13-6-14-22-33)44(30-15-7-3-8-16-30,31-17-9-4-10-18-31)32-19-11-5-12-20-32/h3-26,39H,2,27H2,1H3/b38-34- |
| InChIKey | QBQOHPWGAUFEJP-RXJYLVDRSA-N |
| XLogP | 6.25 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.61 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|