C32H33N2O6PS — CID 102408278
diethyl 2-[2-(benzenesulfonyl)hydrazinyl]-3-(triphenyl-λ5-phosphanylidene)butanedioate (PubChem CID 102408278) has the molecular formula C32H33N2O6PS and a molecular weight of 604.67 g/mol. Its IUPAC name is diethyl 2-[2-(benzenesulfonyl)hydrazinyl]-3-(triphenyl-λ5-phosphanylidene)butanedioate.
| Compound Name | diethyl 2-[2-(benzenesulfonyl)hydrazinyl]-3-(triphenyl-λ5-phosphanylidene)butanedioate |
|---|---|
| PubChem CID | 102408278 |
| Molecular Formula | C32H33N2O6PS |
| Molecular Weight | 604.67 g/mol |
| Exact Mass | 604.18 |
| IUPAC Name | diethyl 2-[2-(benzenesulfonyl)hydrazinyl]-3-(triphenyl-λ5-phosphanylidene)butanedioate |
| SMILES | CCOC(=O)C(C(NNS(=O)(=O)c1ccccc1)C(=O)OCC)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H33N2O6PS/c1-3-39-31(35)29(33-34-42(37,38)28-23-15-8-16-24-28)30(32(36)40-4-2)41(25-17-9-5-10-18-25,26-19-11-6-12-20-26)27-21-13-7-14-22-27/h5-24,29,33-34H,3-4H2,1-2H3 |
| InChIKey | JPKMZSYKRBYITE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.67 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|