C11H14N2O5S — CID 103308934
ethyl 2-amino-3-(benzenesulfonamido)-3-oxopropanoate (PubChem CID 103308934) has the molecular formula C11H14N2O5S and a molecular weight of 286.31 g/mol. Its IUPAC name is ethyl 2-amino-3-(benzenesulfonamido)-3-oxopropanoate.
| Compound Name | ethyl 2-amino-3-(benzenesulfonamido)-3-oxopropanoate |
|---|---|
| PubChem CID | 103308934 |
| Molecular Formula | C11H14N2O5S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | ethyl 2-amino-3-(benzenesulfonamido)-3-oxopropanoate |
| SMILES | CCOC(=O)C(N)C(=O)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H14N2O5S/c1-2-18-11(15)9(12)10(14)13-19(16,17)8-6-4-3-5-7-8/h3-7,9H,2,12H2,1H3,(H,13,14) |
| InChIKey | HXTXMTMKJXPJGW-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|