C11H14BrNO3S — CID 7035642
(2S)-N-(benzenesulfonyl)-2-bromopentanamide (PubChem CID 7035642) has the molecular formula C11H14BrNO3S and a molecular weight of 320.21 g/mol. Its IUPAC name is (2S)-N-(benzenesulfonyl)-2-bromopentanamide.
| Compound Name | (2S)-N-(benzenesulfonyl)-2-bromopentanamide |
|---|---|
| PubChem CID | 7035642 |
| Molecular Formula | C11H14BrNO3S |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | (2S)-N-(benzenesulfonyl)-2-bromopentanamide |
| SMILES | CCC[C@H](Br)C(=O)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H14BrNO3S/c1-2-6-10(12)11(14)13-17(15,16)9-7-4-3-5-8-9/h3-5,7-8,10H,2,6H2,1H3,(H,13,14)/t10-/m0/s1 |
| InChIKey | HOYKZBHWMDHTSS-JTQLQIEISA-N |
| XLogP | 2.06 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|