C11H13F2NO3S — CID 149392141
(2S)-N-(benzenesulfonyl)-4,4-difluoro-2-methylbutanamide (PubChem CID 149392141) has the molecular formula C11H13F2NO3S and a molecular weight of 277.29 g/mol. Its IUPAC name is (2S)-N-(benzenesulfonyl)-4,4-difluoro-2-methylbutanamide.
| Compound Name | (2S)-N-(benzenesulfonyl)-4,4-difluoro-2-methylbutanamide |
|---|---|
| PubChem CID | 149392141 |
| Molecular Formula | C11H13F2NO3S |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | (2S)-N-(benzenesulfonyl)-4,4-difluoro-2-methylbutanamide |
| SMILES | C[C@@H](CC(F)F)C(=O)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H13F2NO3S/c1-8(7-10(12)13)11(15)14-18(16,17)9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3,(H,14,15)/t8-/m0/s1 |
| InChIKey | YNSWCBSOXIVMLV-QMMMGPOBSA-N |
| XLogP | 1.78 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |