C8H7Cl2NO3S — CID 3778605
N-(benzenesulfonyl)-2,2-dichloroacetamide (PubChem CID 3778605) has the molecular formula C8H7Cl2NO3S and a molecular weight of 268.12 g/mol. Its IUPAC name is N-(benzenesulfonyl)-2,2-dichloroacetamide.
| Compound Name | N-(benzenesulfonyl)-2,2-dichloroacetamide |
|---|---|
| PubChem CID | 3778605 |
| Molecular Formula | C8H7Cl2NO3S |
| Molecular Weight | 268.12 g/mol |
| Exact Mass | 266.95 |
| IUPAC Name | N-(benzenesulfonyl)-2,2-dichloroacetamide |
| SMILES | O=C(NS(=O)(=O)c1ccccc1)C(Cl)Cl |
| InChI | InChI=1S/C8H7Cl2NO3S/c9-7(10)8(12)11-15(13,14)6-4-2-1-3-5-6/h1-5,7H,(H,11,12) |
| InChIKey | QDHSNPAUYQEVTG-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.12 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|