About (E)-N'-(benzenesulfonyl)but-2-enediamide
(E)-N'-(benzenesulfonyl)but-2-enediamide (PubChem CID 22610827) has the molecular formula C10H10N2O4S
and a molecular weight of 254.27 g/mol. Its IUPAC name is (E)-N'-(benzenesulfonyl)but-2-enediamide.
Molecular Properties
| Compound Name | (E)-N'-(benzenesulfonyl)but-2-enediamide |
| PubChem CID | 22610827 |
| Molecular Formula | C10H10N2O4S |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | (E)-N'-(benzenesulfonyl)but-2-enediamide |
| SMILES | NC(=O)/C=C/C(=O)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C10H10N2O4S/c11-9(13)6-7-10(14)12-17(15,16)8-4-2-1-3-5-8/h1-7H,(H2,11,13)(H,12,14)/b7-6+ |
| InChIKey | NPDBJJJMEUDMNQ-VOTSOKGWSA-N |
| XLogP | -0.47 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N'-(benzenesulfonyl)but-2-enediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N'-(benzenesulfonyl)but-2-enediamide?
The IUPAC name of (E)-N'-(benzenesulfonyl)but-2-enediamide (CID 22610827) is (E)-N'-(benzenesulfonyl)but-2-enediamide.
What is the SMILES notation for (E)-N'-(benzenesulfonyl)but-2-enediamide?
The canonical SMILES for (E)-N'-(benzenesulfonyl)but-2-enediamide is NC(=O)/C=C/C(=O)NS(=O)(=O)c1ccccc1.
What is the InChIKey of (E)-N'-(benzenesulfonyl)but-2-enediamide?
The InChIKey is NPDBJJJMEUDMNQ-VOTSOKGWSA-N. The full InChI is InChI=1S/C10H10N2O4S/c11-9(13)6-7-10(14)12-17(15,16)8-4-2-1-3-5-8/h1-7H,(H2,11,13)(H,12,14)/b7-6+.
What are the key properties of (E)-N'-(benzenesulfonyl)but-2-enediamide?
(E)-N'-(benzenesulfonyl)but-2-enediamide has a molecular weight of 254.27 g/mol, XLogP of -0.47, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N'-(benzenesulfonyl)but-2-enediamide is sourced from PubChem (CID 22610827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).