About benzenesulfonohydrazide;(E)-carbamoyliminourea
benzenesulfonohydrazide;(E)-carbamoyliminourea (PubChem CID 18359618) has the molecular formula C8H12N6O4S
and a molecular weight of 288.29 g/mol. Its IUPAC name is benzenesulfonohydrazide;(E)-carbamoyliminourea.
Molecular Properties
| Compound Name | benzenesulfonohydrazide;(E)-carbamoyliminourea |
| PubChem CID | 18359618 |
| Molecular Formula | C8H12N6O4S |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | benzenesulfonohydrazide;(E)-carbamoyliminourea |
| SMILES | NC(=O)/N=N/C(N)=O.NNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C6H8N2O2S.C2H4N4O2/c7-8-11(9,10)6-4-2-1-3-5-6;3-1(7)5-6-2(4)8/h1-5,8H,7H2;(H2,3,7)(H2,4,8)/b;6-5+ |
| InChIKey | MWUDXGABLJCPSH-MXDQRGINSA-N |
| XLogP | -0.57 |
| TPSA | 183.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzenesulfonohydrazide;(E)-carbamoyliminourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfonohydrazide;(E)-carbamoyliminourea?
The IUPAC name of benzenesulfonohydrazide;(E)-carbamoyliminourea (CID 18359618) is benzenesulfonohydrazide;(E)-carbamoyliminourea.
What is the SMILES notation for benzenesulfonohydrazide;(E)-carbamoyliminourea?
The canonical SMILES for benzenesulfonohydrazide;(E)-carbamoyliminourea is NC(=O)/N=N/C(N)=O.NNS(=O)(=O)c1ccccc1.
What is the InChIKey of benzenesulfonohydrazide;(E)-carbamoyliminourea?
The InChIKey is MWUDXGABLJCPSH-MXDQRGINSA-N. The full InChI is InChI=1S/C6H8N2O2S.C2H4N4O2/c7-8-11(9,10)6-4-2-1-3-5-6;3-1(7)5-6-2(4)8/h1-5,8H,7H2;(H2,3,7)(H2,4,8)/b;6-5+.
What are the key properties of benzenesulfonohydrazide;(E)-carbamoyliminourea?
benzenesulfonohydrazide;(E)-carbamoyliminourea has a molecular weight of 288.29 g/mol, XLogP of -0.57, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfonohydrazide;(E)-carbamoyliminourea is sourced from PubChem (CID 18359618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).