About benzenesulfonohydrazide;hydrate
benzenesulfonohydrazide;hydrate (PubChem CID 21414143) has the molecular formula C12H18N4O5S2
and a molecular weight of 362.43 g/mol. Its IUPAC name is benzenesulfonohydrazide;hydrate.
Molecular Properties
| Compound Name | benzenesulfonohydrazide;hydrate |
| PubChem CID | 21414143 |
| Molecular Formula | C12H18N4O5S2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | benzenesulfonohydrazide;hydrate |
| SMILES | NNS(=O)(=O)c1ccccc1.NNS(=O)(=O)c1ccccc1.O |
| InChI | InChI=1S/2C6H8N2O2S.H2O/c2*7-8-11(9,10)6-4-2-1-3-5-6;/h2*1-5,8H,7H2;1H2 |
| InChIKey | NGCRRLYXKMTLKX-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 175.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzenesulfonohydrazide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfonohydrazide;hydrate?
The IUPAC name of benzenesulfonohydrazide;hydrate (CID 21414143) is benzenesulfonohydrazide;hydrate.
What is the SMILES notation for benzenesulfonohydrazide;hydrate?
The canonical SMILES for benzenesulfonohydrazide;hydrate is NNS(=O)(=O)c1ccccc1.NNS(=O)(=O)c1ccccc1.O.
What is the InChIKey of benzenesulfonohydrazide;hydrate?
The InChIKey is NGCRRLYXKMTLKX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H8N2O2S.H2O/c2*7-8-11(9,10)6-4-2-1-3-5-6;/h2*1-5,8H,7H2;1H2.
What are the key properties of benzenesulfonohydrazide;hydrate?
benzenesulfonohydrazide;hydrate has a molecular weight of 362.43 g/mol, XLogP of -1.15, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfonohydrazide;hydrate is sourced from PubChem (CID 21414143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).