C32H27NO5S — CID 10230505
4-[[(E)-3-[4-[(Z)-1,2-diphenylbut-1-enyl]phenyl]prop-2-enoyl]sulfamoyl]benzoic acid (PubChem CID 10230505) has the molecular formula C32H27NO5S and a molecular weight of 537.64 g/mol. Its IUPAC name is 4-[[(E)-3-[4-[(Z)-1,2-diphenylbut-1-enyl]phenyl]prop-2-enoyl]sulfamoyl]benzoic acid.
| Compound Name | 4-[[(E)-3-[4-[(Z)-1,2-diphenylbut-1-enyl]phenyl]prop-2-enoyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 10230505 |
| Molecular Formula | C32H27NO5S |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | 4-[[(E)-3-[4-[(Z)-1,2-diphenylbut-1-enyl]phenyl]prop-2-enoyl]sulfamoyl]benzoic acid |
| SMILES | CC/C(=C(\c1ccccc1)c1ccc(/C=C/C(=O)NS(=O)(=O)c2ccc(C(=O)O)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C32H27NO5S/c1-2-29(24-9-5-3-6-10-24)31(25-11-7-4-8-12-25)26-16-13-23(14-17-26)15-22-30(34)33-39(37,38)28-20-18-27(19-21-28)32(35)36/h3-22H,2H2,1H3,(H,33,34)(H,35,36)/b22-15+,31-29- |
| InChIKey | KFAVIVQWHYMDFQ-XAGRJKKMSA-N |
| XLogP | 6.27 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|