C20H23N3O4S — CID 38826839
N-[2-[[(E)-3-[4-(ethylsulfamoyl)phenyl]prop-2-enoyl]amino]ethyl]benzamide (PubChem CID 38826839) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is N-[2-[[(E)-3-[4-(ethylsulfamoyl)phenyl]prop-2-enoyl]amino]ethyl]benzamide.
| Compound Name | N-[2-[[(E)-3-[4-(ethylsulfamoyl)phenyl]prop-2-enoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 38826839 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | N-[2-[[(E)-3-[4-(ethylsulfamoyl)phenyl]prop-2-enoyl]amino]ethyl]benzamide |
| SMILES | CCNS(=O)(=O)c1ccc(/C=C/C(=O)NCCNC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H23N3O4S/c1-2-23-28(26,27)18-11-8-16(9-12-18)10-13-19(24)21-14-15-22-20(25)17-6-4-3-5-7-17/h3-13,23H,2,14-15H2,1H3,(H,21,24)(H,22,25)/b13-10+ |
| InChIKey | RFSATBZZYKGCIP-JLHYYAGUSA-N |
| XLogP | 1.54 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|