C20H22FN3O4S — CID 33329912
3-fluoro-4-methyl-N-[2-[[(E)-3-[4-(methylsulfamoyl)phenyl]prop-2-enoyl]amino]ethyl]benzamide (PubChem CID 33329912) has the molecular formula C20H22FN3O4S and a molecular weight of 419.48 g/mol. Its IUPAC name is 3-fluoro-4-methyl-N-[2-[[(E)-3-[4-(methylsulfamoyl)phenyl]prop-2-enoyl]amino]ethyl]benzamide.
| Compound Name | 3-fluoro-4-methyl-N-[2-[[(E)-3-[4-(methylsulfamoyl)phenyl]prop-2-enoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 33329912 |
| Molecular Formula | C20H22FN3O4S |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 3-fluoro-4-methyl-N-[2-[[(E)-3-[4-(methylsulfamoyl)phenyl]prop-2-enoyl]amino]ethyl]benzamide |
| SMILES | CNS(=O)(=O)c1ccc(/C=C/C(=O)NCCNC(=O)c2ccc(C)c(F)c2)cc1 |
| InChI | InChI=1S/C20H22FN3O4S/c1-14-3-7-16(13-18(14)21)20(26)24-12-11-23-19(25)10-6-15-4-8-17(9-5-15)29(27,28)22-2/h3-10,13,22H,11-12H2,1-2H3,(H,23,25)(H,24,26)/b10-6+ |
| InChIKey | KJVWXCUIKSJESP-UXBLZVDNSA-N |
| XLogP | 1.60 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|