C19H21BrFN3O4S — CID 33326222
N-[2-[3-[(4-bromophenyl)sulfonylamino]propanoylamino]ethyl]-3-fluoro-4-methylbenzamide (PubChem CID 33326222) has the molecular formula C19H21BrFN3O4S and a molecular weight of 486.36 g/mol. Its IUPAC name is N-[2-[3-[(4-bromophenyl)sulfonylamino]propanoylamino]ethyl]-3-fluoro-4-methylbenzamide.
| Compound Name | N-[2-[3-[(4-bromophenyl)sulfonylamino]propanoylamino]ethyl]-3-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 33326222 |
| Molecular Formula | C19H21BrFN3O4S |
| Molecular Weight | 486.36 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | N-[2-[3-[(4-bromophenyl)sulfonylamino]propanoylamino]ethyl]-3-fluoro-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCNC(=O)CCNS(=O)(=O)c2ccc(Br)cc2)cc1F |
| InChI | InChI=1S/C19H21BrFN3O4S/c1-13-2-3-14(12-17(13)21)19(26)23-11-10-22-18(25)8-9-24-29(27,28)16-6-4-15(20)5-7-16/h2-7,12,24H,8-11H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | ZVFYPOHHUWEOHI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|