C14H22BrN3O3S — CID 4781268
3-[(4-bromophenyl)sulfonylamino]-N-[3-(dimethylamino)propyl]propanamide (PubChem CID 4781268) has the molecular formula C14H22BrN3O3S and a molecular weight of 392.32 g/mol. Its IUPAC name is 3-[(4-bromophenyl)sulfonylamino]-N-[3-(dimethylamino)propyl]propanamide.
| Compound Name | 3-[(4-bromophenyl)sulfonylamino]-N-[3-(dimethylamino)propyl]propanamide |
|---|---|
| PubChem CID | 4781268 |
| Molecular Formula | C14H22BrN3O3S |
| Molecular Weight | 392.32 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 3-[(4-bromophenyl)sulfonylamino]-N-[3-(dimethylamino)propyl]propanamide |
| SMILES | CN(C)CCCNC(=O)CCNS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H22BrN3O3S/c1-18(2)11-3-9-16-14(19)8-10-17-22(20,21)13-6-4-12(15)5-7-13/h4-7,17H,3,8-11H2,1-2H3,(H,16,19) |
| InChIKey | HFCXBOHERWGMAA-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|