C13H18BrN3O4S — CID 9480766
3-[(4-bromophenyl)sulfonylamino]-N-[2-(dimethylamino)-2-oxoethyl]propanamide (PubChem CID 9480766) has the molecular formula C13H18BrN3O4S and a molecular weight of 392.28 g/mol. Its IUPAC name is 3-[(4-bromophenyl)sulfonylamino]-N-[2-(dimethylamino)-2-oxoethyl]propanamide.
| Compound Name | 3-[(4-bromophenyl)sulfonylamino]-N-[2-(dimethylamino)-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 9480766 |
| Molecular Formula | C13H18BrN3O4S |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | 3-[(4-bromophenyl)sulfonylamino]-N-[2-(dimethylamino)-2-oxoethyl]propanamide |
| SMILES | CN(C)C(=O)CNC(=O)CCNS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H18BrN3O4S/c1-17(2)13(19)9-15-12(18)7-8-16-22(20,21)11-5-3-10(14)4-6-11/h3-6,16H,7-9H2,1-2H3,(H,15,18) |
| InChIKey | OGNMDHDAFHPXSD-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |