C17H20BrN3O5S2 — CID 26644643
3-[(4-bromophenyl)sulfonylamino]-N-[3-(dimethylsulfamoyl)phenyl]propanamide (PubChem CID 26644643) has the molecular formula C17H20BrN3O5S2 and a molecular weight of 490.40 g/mol. Its IUPAC name is 3-[(4-bromophenyl)sulfonylamino]-N-[3-(dimethylsulfamoyl)phenyl]propanamide.
| Compound Name | 3-[(4-bromophenyl)sulfonylamino]-N-[3-(dimethylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 26644643 |
| Molecular Formula | C17H20BrN3O5S2 |
| Molecular Weight | 490.40 g/mol |
| Exact Mass | 489.00 |
| IUPAC Name | 3-[(4-bromophenyl)sulfonylamino]-N-[3-(dimethylsulfamoyl)phenyl]propanamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=O)CCNS(=O)(=O)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C17H20BrN3O5S2/c1-21(2)28(25,26)16-5-3-4-14(12-16)20-17(22)10-11-19-27(23,24)15-8-6-13(18)7-9-15/h3-9,12,19H,10-11H2,1-2H3,(H,20,22) |
| InChIKey | ISRLUEWNDWCWGJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |